|
CAS#: 655-25-4 Product: 2,2,2-Trifluoro-1-Phenylethanone Oxime No suppilers available for the product. |
| Name | 2,2,2-Trifluoro-1-Phenylethanone Oxime |
|---|---|
| Synonyms | 2,2,2-Trifluoro-1-Phenyl-Ethanone Oxime; 2,2,2-Trifluoro-1-Phenylethanone Oxime; (Nz)-N-(2,2,2-Trifluoro-1-Phenyl-Ethylidene)Hydroxylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6F3NO |
| Molecular Weight | 189.14 |
| CAS Registry Number | 655-25-4 |
| SMILES | C1=C(/C(=N/O)C(F)(F)F)C=CC=C1 |
| InChI | 1S/C8H6F3NO/c9-8(10,11)7(12-13)6-4-2-1-3-5-6/h1-5,13H/b12-7- |
| InChIKey | TUKWYJVGKNCDJJ-GHXNOFRVSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 194.096°C at 760 mmHg (Cal.) |
| Flash point | 71.187°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trifluoro-1-Phenylethanone Oxime |