|
CAS#: 65556-19-6 Product: 19-Norandrosterone No suppilers available for the product. |
| Name | 19-Norandrosterone |
|---|---|
| Synonyms | 19-Norandrosterone; 19-Noreoiandrosterone; 19-Noretiocholanolone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 |
| CAS Registry Number | 65556-19-6 |
| SMILES | [C@H]13[C@@H]([C@@H]2C(CC1)CC(O)CC2)CC[C@]4([C@H]3CCC4=O)C |
| InChI | 1S/C18H28O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h11-16,19H,2-10H2,1H3/t11?,12?,13-,14+,15+,16-,18-/m0/s1 |
| InChIKey | UOUIARGWRPHDBX-AWLYHSJUSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.874°C at 760 mmHg (Cal.) |
| Flash point | 176.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 19-Norandrosterone |