|
CAS#: 65571-75-7 Product: Methyl (5Z)-5-(cyanomethylene)-L-prolinate No suppilers available for the product. |
| Name | Methyl (5Z)-5-(cyanomethylene)-L-prolinate |
|---|---|
| Synonyms | (S,Z)-methyl 5-(cyanomethylene)pyrrolidine-2-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 |
| CAS Registry Number | 65571-75-7 |
| SMILES | COC(=O)[C@@H]1CC/C(=C/C#N)/N1 |
| InChI | 1S/C8H10N2O2/c1-12-8(11)7-3-2-6(10-7)4-5-9/h4,7,10H,2-3H2,1H3/b6-4-/t7-/m0/s1 |
| InChIKey | RKPPAGDTSUPCGI-NGAMADIESA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.459°C at 760 mmHg (Cal.) |
| Flash point | 133.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (5Z)-5-(cyanomethylene)-L-prolinate |