|
CAS#: 65652-43-9 Product: Benzyltrichlorobenzene No suppilers available for the product. |
| Name | Benzyltrichlorobenzene |
|---|---|
| Synonyms | 2-(Benzyl)-1,3,5-Trichloro-Benzene; (Trichlorophenyl)Phenylmethane; Benzene, Trichloro(Phenylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Cl3 |
| Molecular Weight | 271.57 |
| CAS Registry Number | 65652-43-9 |
| EINECS | 265-861-9 |
| SMILES | C1=C(C=C(Cl)C(=C1Cl)CC2=CC=CC=C2)Cl |
| InChI | 1S/C13H9Cl3/c14-10-7-12(15)11(13(16)8-10)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2 |
| InChIKey | DFCHLMGRYVGFSL-UHFFFAOYSA-N |
| Density | 1.327g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.743°C at 760 mmHg (Cal.) |
| Flash point | 238.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyltrichlorobenzene |