|
CAS#: 65659-61-2 Product: 15(S)-15-Methyl delta(4)-Prostaglandin F1alpha No suppilers available for the product. |
| Name | 15(S)-15-Methyl delta(4)-Prostaglandin F1alpha |
|---|---|
| Synonyms | (Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(E,3S)-3-Hydroxy-3-Methyl-Oct-1-Enyl]Cyclopentyl]Hept-4-Enoic Acid; (4Z,9Alpha,11Alpha,13E,15S)-9,11,15-Trihydroxy-15-Methylprosta-4,13-Dien-1-Oic Acid; 15(S)-15-Methyl Delta(4)-Cis-Prostaglandin F1alpha |
| Molecular Structure | ![]() |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 |
| CAS Registry Number | 65659-61-2 |
| SMILES | [C@H]1([C@H]([C@@H](O)C[C@H]1O)CC\C=C/CCC(=O)O)\C=C\[C@@](O)(CCCCC)C |
| InChI | 1S/C21H36O5/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5-6,12,14,16-19,22-23,26H,3-4,7-11,13,15H2,1-2H3,(H,24,25)/b6-5-,14-12+/t16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | JTYIBILYKUHKTE-WLPXDPPTSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.823°C at 760 mmHg (Cal.) |
| Flash point | 291.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 15(S)-15-Methyl delta(4)-Prostaglandin F1alpha |