Online Database of Chemicals from Around the World
|
CAS#: 65678-12-8 Product: 5-(Tert-Butyl)-3-Chloro-4-Hydroxybenzaldehyde No suppilers available for the product. |
| Name | 5-(Tert-Butyl)-3-Chloro-4-Hydroxybenzaldehyde |
|---|---|
| Synonyms | 3-Tert-Butyl-5-Chloro-4-Hydroxy-Benzaldehyde; 5-(Tert-Butyl)-3-Chloro-4-Hydroxybenzaldehyde |
| Molecular Structure |  |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 |
| CAS Registry Number | 65678-12-8 |
| EINECS | 265-872-9 |
| SMILES | C1=C(C=O)C=C(C(C)(C)C)C(=C1Cl)O |
| InChI | 1S/C11H13ClO2/c1-11(2,3)8-4-7(6-13)5-9(12)10(8)14/h4-6,14H,1-3H3 |
| InChIKey | VRDIKTAXORPVGA-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.547°C at 760 mmHg (Cal.) |
| Flash point | 115.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Tert-Butyl)-3-Chloro-4-Hydroxybenzaldehyde |