Online Database of Chemicals from Around the World
|
CAS#: 65691-00-1 Product: 5-(4-Chlorophenyl)-2,3-Diphenyl-Thiophene No suppilers available for the product. |
| Name | 5-(4-Chlorophenyl)-2,3-Diphenyl-Thiophene |
|---|---|
| Synonyms | 2,3-Diphenyl-5-P-Chlorophenyl Thiophene; 5-(4-Chlorophenyl)-2,3-Diphenylthiophene; Ai3-29605 |
| Molecular Structure |  |
| Molecular Formula | C22H15ClS |
| Molecular Weight | 346.87 |
| CAS Registry Number | 65691-00-1 |
| SMILES | C1=C(SC(=C1C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
| InChI | 1S/C22H15ClS/c23-19-13-11-17(12-14-19)21-15-20(16-7-3-1-4-8-16)22(24-21)18-9-5-2-6-10-18/h1-15H |
| InChIKey | JWXZLCFGVKMEEK-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.535°C at 760 mmHg (Cal.) |
| Flash point | 271.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(4-Chlorophenyl)-2,3-Diphenyl-Thiophene |