|
CAS#: 65697-87-2 Product: 3-(o-Tolyl)-5-(m-Tolyl)-1H-1,2,4-Triazole No suppilers available for the product. |
| Name | 3-(o-Tolyl)-5-(m-Tolyl)-1H-1,2,4-Triazole |
|---|---|
| Synonyms | 1H-1,2,4-Triazole, 3-(2-Methylphenyl)-5-(3-Methylphenyl)-; 3-(O-Tolyl)-5-(M-Tolyl)-S-Triazole; Brn 0615473 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.31 |
| CAS Registry Number | 65697-87-2 |
| SMILES | C3=C(C1=NC(=N[NH]1)C2=CC=CC(=C2)C)C(=CC=C3)C |
| InChI | 1S/C16H15N3/c1-11-6-5-8-13(10-11)15-17-16(19-18-15)14-9-4-3-7-12(14)2/h3-10H,1-2H3,(H,17,18,19) |
| InChIKey | IYAFRQXASXFWNX-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.066°C at 760 mmHg (Cal.) |
| Flash point | 216.472°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(o-Tolyl)-5-(m-Tolyl)-1H-1,2,4-Triazole |