|
CAS#: 65879-44-9 Product: 2,4-Diamino-6-Methylphenol Hydrochloride No suppilers available for the product. |
| Name | 2,4-Diamino-6-Methylphenol Hydrochloride |
|---|---|
| Synonyms | 2,4-Diamino-6-Methyl-Phenol Hydrochloride; 4,6-Diamino-2-Methylphenol Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H11ClN2O |
| Molecular Weight | 174.63 |
| CAS Registry Number | 65879-44-9 |
| EINECS | 265-960-7 |
| SMILES | [H+].C1=C(C(=C(N)C=C1N)O)C.[Cl-] |
| InChI | 1S/C7H10N2O.ClH/c1-4-2-5(8)3-6(9)7(4)10;/h2-3,10H,8-9H2,1H3;1H |
| InChIKey | KFKLSCXTXRXTCC-UHFFFAOYSA-N |
| Boiling point | 328.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 152.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diamino-6-Methylphenol Hydrochloride |