Online Database of Chemicals from Around the World
|
CAS#: 6593-13-1 Product: Lanostane-3,7,11-Trione No suppilers available for the product. |
| Name | Lanostane-3,7,11-Trione |
|---|---|
| Synonyms | (5R,8R,9S,10S,13R,14S,17R)-17-[(1R)-1,5-Dimethylhexyl]-4,4,10,13,14-Pentamethyl-1,2,5,6,8,9,12,15,16,17-Decahydrocyclopenta[A]Phenanthrene-3,7,11-Trione; Nsc76619; Lanostane-3,7,11-Trione |
| Molecular Structure |  |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 |
| CAS Registry Number | 6593-13-1 |
| SMILES | [C@H](CCCC(C)C)(C)[C@@H]4[C@]3(CC([C@@H]2[C@]1(CCC(=O)C(C)(C)[C@@H]1CC([C@H]2[C@@]3(CC4)C)=O)C)=O)C |
| InChI | 1S/C30H48O3/c1-18(2)10-9-11-19(3)20-12-15-29(7)26-21(31)16-23-27(4,5)24(33)13-14-28(23,6)25(26)22(32)17-30(20,29)8/h18-20,23,25-26H,9-17H2,1-8H3/t19-,20-,23+,25+,26-,28+,29+,30-/m1/s1 |
| InChIKey | JIFAVYOCBSTCGM-CCYCMEPCSA-N |
| Density | 1.011g/cm3 (Cal.) |
|---|---|
| Boiling point | 542.158°C at 760 mmHg (Cal.) |
| Flash point | 224.673°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lanostane-3,7,11-Trione |