|
CAS#: 66041-61-0 Product: 4,4'-Dihydroxy-3,3'-Dinitrobiphenyl No suppilers available for the product. |
| Name | 4,4'-Dihydroxy-3,3'-Dinitrobiphenyl |
|---|---|
| Synonyms | 4-(4-Hydroxy-3-Nitro-Phenyl)-2-Nitro-Phenol; 4,4'-Dihydroxy-3,3'-Dinitrobiphenyl; Ccris 5767 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N2O6 |
| CAS Registry Number | 66041-61-0 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1C2=CC=C(O)C(=C2)[N+]([O-])=O)O |
| InChI | 1S/C12H8N2O6/c15-11-3-1-7(5-9(11)13(17)18)8-2-4-12(16)10(6-8)14(19)20/h1-6,15-16H |
| InChIKey | NTXCSKZBHUKPQU-UHFFFAOYSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.076°C at 760 mmHg (Cal.) |
| Flash point | 175.029°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Dihydroxy-3,3'-Dinitrobiphenyl |