|
CAS#: 66225-82-9 Product: Technetium Tc 99M N-(Methylamino)Methylene Diphosphonate No suppilers available for the product. |
| Name | Technetium Tc 99M N-(Methylamino)Methylene Diphosphonate |
|---|---|
| Synonyms | (Methylamino-Phosphono-Methyl)Phosphonic Acid; Technetium; Moli000614; Tc-99M-Nmmdp |
| Molecular Structure | ![]() |
| Molecular Formula | C2H9NO6P2Tc |
| Molecular Weight | 303.95 |
| CAS Registry Number | 66225-82-9 |
| SMILES | [99Tc].CNC([P](=O)(O)O)[P](=O)(O)O |
| InChI | 1S/C2H9NO6P2.Tc/c1-3-2(10(4,5)6)11(7,8)9;/h2-3H,1H3,(H2,4,5,6)(H2,7,8,9);/i;1+1 |
| InChIKey | YKZZJHKJPYTWFX-IEOVAKBOSA-N |
| Boiling point | 528.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 273.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Technetium Tc 99M N-(Methylamino)Methylene Diphosphonate |