|
CAS#: 6635-06-9 Product: 4aH-Anthracene-2,9,10-Trione No suppilers available for the product. |
| Name | 4aH-Anthracene-2,9,10-Trione |
|---|---|
| Synonyms | 2,9,10(4Ah)-Anthracenetrione; Nsc40646 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O3 |
| Molecular Weight | 224.22 |
| CAS Registry Number | 6635-06-9 |
| SMILES | C1=CC=CC3=C1C(=O)C2=CC(C=CC2C3=O)=O |
| InChI | 1S/C14H8O3/c15-8-5-6-11-12(7-8)14(17)10-4-2-1-3-9(10)13(11)16/h1-7,11H |
| InChIKey | GQPFPOXHEFMSRT-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.766°C at 760 mmHg (Cal.) |
| Flash point | 205.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4aH-Anthracene-2,9,10-Trione |