|
CAS#: 6640-28-4 Product: 2,4-Dichloro-6-(Phenylamino)Methyl-Phenol Hydrochloride No suppilers available for the product. |
| Name | 2,4-Dichloro-6-(Phenylamino)Methyl-Phenol Hydrochloride |
|---|---|
| Synonyms | Nsc48851 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12Cl3NO |
| Molecular Weight | 304.60 |
| CAS Registry Number | 6640-28-4 |
| SMILES | [H+].C1=C(Cl)C=C(Cl)C(=C1CNC2=CC=CC=C2)O.[Cl-] |
| InChI | 1S/C13H11Cl2NO.ClH/c14-10-6-9(13(17)12(15)7-10)8-16-11-4-2-1-3-5-11;/h1-7,16-17H,8H2;1H |
| InChIKey | MNYIYBWWCMYYHK-UHFFFAOYSA-N |
| Boiling point | 395°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 192.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-6-(Phenylamino)Methyl-Phenol Hydrochloride |