|
CAS#: 6647-27-4 Product: 4,11-Diamino-2-(2-Methylpropyl)-1H-Naphth[2,3-f]Isoindole-1,3,5,10(2H)-Tetrone No suppilers available for the product. |
| Name | 4,11-Diamino-2-(2-Methylpropyl)-1H-Naphth[2,3-f]Isoindole-1,3,5,10(2H)-Tetrone |
|---|---|
| Synonyms | 4,11-Diamino-2-Isobutyl-Naphtho[3,2-F]Isoindole-1,3,5,10-Tetrone; 4,11-Diamino-2-Isobutylnaphtho[3,2-F]Isoindole-1,3,5,10-Tetrone; 4,11-Diamino-2-Isobutyl-Naphtho[3,2-F]Isoindole-1,3,5,10-Diquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 |
| CAS Registry Number | 6647-27-4 |
| EINECS | 229-665-7 |
| SMILES | C1=CC=CC3=C1C(=O)C2=C(N)C4=C(C(=C2C3=O)N)C(=O)N(C4=O)CC(C)C |
| InChI | 1S/C20H17N3O4/c1-8(2)7-23-19(26)13-14(20(23)27)16(22)12-11(15(13)21)17(24)9-5-3-4-6-10(9)18(12)25/h3-6,8H,7,21-22H2,1-2H3 |
| InChIKey | HDKCUVFLXISKKK-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 660.772°C at 760 mmHg (Cal.) |
| Flash point | 353.422°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,11-Diamino-2-(2-Methylpropyl)-1H-Naphth[2,3-f]Isoindole-1,3,5,10(2H)-Tetrone |