|
CAS#: 66591-36-4 Product: 3,3,4-Trimethyl-2-Pentanon (2,4-Dinitrophenyl)Hydrazone No suppilers available for the product. |
| Name | 3,3,4-Trimethyl-2-Pentanon (2,4-Dinitrophenyl)Hydrazone |
|---|---|
| Synonyms | 3,3,4-Trimethyl-2-Pentanon (2,4-Dinitrophenyl)Hydrazone; Nsc20727 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 |
| CAS Registry Number | 66591-36-4 |
| SMILES | C1=CC(=CC(=C1N\N=C(C(C(C)C)(C)C)\C)[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C14H20N4O4/c1-9(2)14(4,5)10(3)15-16-12-7-6-11(17(19)20)8-13(12)18(21)22/h6-9,16H,1-5H3/b15-10- |
| InChIKey | MFKMNVPRLDSTNR-GDNBJRDFSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.356°C at 760 mmHg (Cal.) |
| Flash point | 204.396°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4-Trimethyl-2-Pentanon (2,4-Dinitrophenyl)Hydrazone |