|
CAS#: 66596-39-2 Product: 1-(3,4-Dihydroxyphenyl)-4,4-Dimethyl-1-Penten-3-One No suppilers available for the product. |
| Name | 1-(3,4-Dihydroxyphenyl)-4,4-Dimethyl-1-Penten-3-One |
|---|---|
| Synonyms | (E)-1-(3,4-Dihydroxyphenyl)-4,4-Dimethyl-Pent-1-En-3-One; 4-(Tert-Butylcarbonylvinyl)Pyrocatechol; Brn 2262819 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 |
| CAS Registry Number | 66596-39-2 |
| SMILES | C1=C(O)C(=CC=C1\C=C\C(=O)C(C)(C)C)O |
| InChI | 1S/C13H16O3/c1-13(2,3)12(16)7-5-9-4-6-10(14)11(15)8-9/h4-8,14-15H,1-3H3/b7-5+ |
| InChIKey | AESAELLIDNODSF-FNORWQNLSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 393.954°C at 760 mmHg (Cal.) |
| Flash point | 206.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dihydroxyphenyl)-4,4-Dimethyl-1-Penten-3-One |