|
CAS#: 6664-99-9 Product: 2-Deoxy-Lyxo-Hexose No suppilers available for the product. |
| Name | 2-Deoxy-Lyxo-Hexose |
|---|---|
| Synonyms | Lyxo-Hexose, 2-Deoxy-; 2-Deoxy-Lyxo-Hexose |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 |
| CAS Registry Number | 6664-99-9 |
| SMILES | [C@H](O)([C@@H](O)[C@H](O)CO)CCO |
| InChI | 1S/C6H14O5/c7-2-1-4(9)6(11)5(10)3-8/h4-11H,1-3H2/t4-,5-,6-/m1/s1 |
| InChIKey | LWWIYCLYWKAKRR-HSUXUTPPSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 480.041°C at 760 mmHg (Cal.) |
| Flash point | 250.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxy-Lyxo-Hexose |