|
CAS#: 66640-67-3 Product: 4-Methylsulfonyl-2,4',5-Trichlorobiphenyl No suppilers available for the product. |
| Name | 4-Methylsulfonyl-2,4',5-Trichlorobiphenyl |
|---|---|
| Synonyms | 1,4-Dichloro-2-(4-Chlorophenyl)-5-Methylsulfonyl-Benzene; 1,4-Dichloro-2-(4-Chlorophenyl)-5-Mesyl-Benzene; 1,1'-Biphenyl, 2,4',5-Trichloro-4-(Methylsulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Cl3O2S |
| Molecular Weight | 335.63 |
| CAS Registry Number | 66640-67-3 |
| SMILES | C1=C(C(=CC(=C1[S](=O)(=O)C)Cl)C2=CC=C(C=C2)Cl)Cl |
| InChI | 1S/C13H9Cl3O2S/c1-19(17,18)13-7-11(15)10(6-12(13)16)8-2-4-9(14)5-3-8/h2-7H,1H3 |
| InChIKey | XICMUQMUKALQAT-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.74°C at 760 mmHg (Cal.) |
| Flash point | 242.124°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methylsulfonyl-2,4',5-Trichlorobiphenyl |