|
CAS#: 6682-59-3 Product: 1-(2,3-Dihydro-1,1,5,6-Tetramethyl-1H-Inden-4-Yl)Ethan-1-One No suppilers available for the product. |
| Name | 1-(2,3-Dihydro-1,1,5,6-Tetramethyl-1H-Inden-4-Yl)Ethan-1-One |
|---|---|
| Synonyms | 1-(1,1,5,6-Tetramethylindan-4-Yl)Ethanone; 1-(1,1,5,6-Tetramethyl-4-Indanyl)Ethanone; 1-(2,3-Dihydro-1,1,5,6-Tetramethyl-1H-Inden-4-Yl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 |
| CAS Registry Number | 6682-59-3 |
| EINECS | 229-721-0 |
| SMILES | C1=C(C(=C(C2=C1C(CC2)(C)C)C(=O)C)C)C |
| InChI | 1S/C15H20O/c1-9-8-13-12(6-7-15(13,4)5)14(10(9)2)11(3)16/h8H,6-7H2,1-5H3 |
| InChIKey | BJZMOVNSHDQGTK-UHFFFAOYSA-N |
| Density | 0.979g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.198°C at 760 mmHg (Cal.) |
| Flash point | 136.912°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Dihydro-1,1,5,6-Tetramethyl-1H-Inden-4-Yl)Ethan-1-One |