|
CAS#: 66827-68-7 Product: N-Ethyl-N-(1-Phenylethyl)Acetamide No suppilers available for the product. |
| Name | N-Ethyl-N-(1-Phenylethyl)Acetamide |
|---|---|
| Synonyms | N-Ethyl-N-(1-Phenylethyl)Ethanamide; Acetamide, N-Ethyl-N-(1-Phenylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 |
| CAS Registry Number | 66827-68-7 |
| SMILES | C1=C(C(N(C(C)=O)CC)C)C=CC=C1 |
| InChI | 1S/C12H17NO/c1-4-13(11(3)14)10(2)12-8-6-5-7-9-12/h5-10H,4H2,1-3H3 |
| InChIKey | VELYNJNBQPPHCZ-UHFFFAOYSA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.766°C at 760 mmHg (Cal.) |
| Flash point | 128.305°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-N-(1-Phenylethyl)Acetamide |