|
CAS#: 66968-06-7 Product: 10-Methylaporphine No suppilers available for the product. |
| Name | 10-Methylaporphine |
|---|---|
| Synonyms | 10-Methylaporphine Hydrochloride; Aporphine, 10-Methyl-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 |
| CAS Registry Number | 66968-06-7 |
| SMILES | [C@H]13C2=C(CC[NH+]1C)C=CC=C2C4=C(C3)C=CC(=C4)C.[Cl-] |
| InChI | 1S/C18H19N.ClH/c1-12-6-7-14-11-17-18-13(8-9-19(17)2)4-3-5-15(18)16(14)10-12;/h3-7,10,17H,8-9,11H2,1-2H3;1H/t17-;/m0./s1 |
| InChIKey | BDLVNGVOYKXWEP-LMOVPXPDSA-N |
| Boiling point | 386.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-Methylaporphine |