|
CAS#: 66997-69-1 Product: 1a,2,3,9c-Tetrahydro-Phenanthro(3,4-b)Oxirene No suppilers available for the product. |
| Name | 1a,2,3,9c-Tetrahydro-Phenanthro(3,4-b)Oxirene |
|---|---|
| Synonyms | Phenanthrenetetrahydro-3,4-Epoxide; Phenanthro(3,4-B)Oxirene, 1,2,3,4-Tetrahydro-; Phenanthro(3,4-B)Oxirene, 1A,2,3,9C-Tetrahydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 |
| CAS Registry Number | 66997-69-1 |
| SMILES | C3=C4C(=C2C1C(O1)CCC2=C3)C=CC=C4 |
| InChI | 1S/C14H12O/c1-2-4-11-9(3-1)5-6-10-7-8-12-14(15-12)13(10)11/h1-6,12,14H,7-8H2 |
| InChIKey | OEQLVOBTUGIXQP-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.18°C at 760 mmHg (Cal.) |
| Flash point | 166.936°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a,2,3,9c-Tetrahydro-Phenanthro(3,4-b)Oxirene |