|
CAS#: 67049-72-3 Product: N-(2-Chloroethyl)-N-Nitrocarbamic Acid Methyl Ester No suppilers available for the product. |
| Name | N-(2-Chloroethyl)-N-Nitrocarbamic Acid Methyl Ester |
|---|---|
| Synonyms | Methyl N-(2-Chloroethyl)-N-Nitro-Carbamate; N-(2-Chloroethyl)-N-Nitrocarbamic Acid Methyl Ester; N-(2-Chloroethyl)-N-Nitro-Carbamic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C4H7ClN2O4 |
| Molecular Weight | 182.56 |
| CAS Registry Number | 67049-72-3 |
| SMILES | C(N([N+]([O-])=O)C(OC)=O)CCl |
| InChI | 1S/C4H7ClN2O4/c1-11-4(8)6(3-2-5)7(9)10/h2-3H2,1H3 |
| InChIKey | WVIOMWUTPSKREM-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.936°C at 760 mmHg (Cal.) |
| Flash point | 107.982°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chloroethyl)-N-Nitrocarbamic Acid Methyl Ester |