|
CAS#: 67253-41-2 Product: (1S-Endo)-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Acrylate No suppilers available for the product. |
| Name | (1S-Endo)-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Acrylate |
|---|---|
| Synonyms | 2-[(1S)-7,7-Dimethylnorbornan-2-Yl]Oxybut-3-En-2-Ol; 2-[[(1S)-7,7-Dimethyl-2-Norbornanyl]Oxy]But-3-En-2-Ol; (1S-Endo)-1,7,7-Trimethylbicyclo(2.2.1)Hept-2-Yl Acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 |
| CAS Registry Number | 67253-41-2 |
| EINECS | 266-625-8 |
| SMILES | [C@H]12C(C(CC1OC(C=C)(O)C)CC2)(C)C |
| InChI | 1S/C13H22O2/c1-5-13(4,14)15-11-8-9-6-7-10(11)12(9,2)3/h5,9-11,14H,1,6-8H2,2-4H3/t9?,10-,11?,13?/m1/s1 |
| InChIKey | HNQKZEYWMXUDOG-AQICRGNOSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.548°C at 760 mmHg (Cal.) |
| Flash point | 80.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S-Endo)-1,7,7-Trimethylbicyclo[2.2.1]Hept-2-Yl Acrylate |