Online Database of Chemicals from Around the World
|
CAS#: 67341-47-3 Product: 1,4-Bis(Methylthio)-2,3,5,6-Tetrachlorobenzene No suppilers available for the product. |
| Name | 1,4-Bis(Methylthio)-2,3,5,6-Tetrachlorobenzene |
|---|---|
| Synonyms | 1,2,4,5-Tetrachloro-3,6-Bis(Methylthio)Benzene; Benzene, 1,2,4,5-Tetrachloro-3,6-Bis(Methylthio)-; Benzene, 3,6-Bis(Methylthio)-1,2,4,5-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C8H6Cl4S2 |
| Molecular Weight | 308.07 |
| CAS Registry Number | 67341-47-3 |
| SMILES | CSC1=C(C(=C(C(=C1Cl)Cl)SC)Cl)Cl |
| InChI | 1S/C8H6Cl4S2/c1-13-7-3(9)5(11)8(14-2)6(12)4(7)10/h1-2H3 |
| InChIKey | BOXRKZAMRDUQCO-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.301°C at 760 mmHg (Cal.) |
| Flash point | 140.524°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(Methylthio)-2,3,5,6-Tetrachlorobenzene |