|
CAS#: 6736-96-5 Product: 7-Chloro-3-phenyl-2-thioxo-1H-quinazolin-4-one No suppilers available for the product. |
| Name | 7-Chloro-3-phenyl-2-thioxo-1H-quinazolin-4-one |
|---|---|
| Synonyms | 7-Chloro-3-Phenyl-2-Thioxo-1H-Quinazolin-4-One; Zinc03316886; Oprea1_702587 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9ClN2OS |
| Molecular Weight | 288.75 |
| CAS Registry Number | 6736-96-5 |
| SMILES | C3=C(N2C(C1=CC=C(C=C1NC2=S)Cl)=O)C=CC=C3 |
| InChI | 1S/C14H9ClN2OS/c15-9-6-7-11-12(8-9)16-14(19)17(13(11)18)10-4-2-1-3-5-10/h1-8H,(H,16,19) |
| InChIKey | KPCPBBQBISDRFL-UHFFFAOYSA-N |
| Density | 1.508g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.257°C at 760 mmHg (Cal.) |
| Flash point | 218.85°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-3-phenyl-2-thioxo-1H-quinazolin-4-one |