|
CAS#: 67464-46-4 Product: Phenanthrene 9,10-Imine No suppilers available for the product. |
| Name | Phenanthrene 9,10-Imine |
|---|---|
| Synonyms | 1H-Phenanthro[9,10-B]Azirine, 1A,9B-Dihydro-; Nsc305486; 1H-Phenanthro(9,10-B)Azirine, 1A,9B-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 |
| CAS Registry Number | 67464-46-4 |
| SMILES | C1=CC=C3C(=C1)C2C(N2)C4=C3C=CC=C4 |
| InChI | 1S/C14H11N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-14/h1-8,13-15H |
| InChIKey | INLXKCRNWNDSBY-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.519°C at 760 mmHg (Cal.) |
| Flash point | 175.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthrene 9,10-Imine |