|
CAS#: 67518-96-1 Product: (1R-Exo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carboxylic Acid No suppilers available for the product. |
| Name | (1R-Exo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carboxylic Acid |
|---|---|
| Synonyms | (1R)-3,3-Dimethylnorbornane-2-Carboxylic Acid; (1R)-3,3-Dimethyl-2-Norbornanecarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 |
| CAS Registry Number | 67518-96-1 (67518-98-3) |
| EINECS | 266-709-4 |
| SMILES | [C@H]12C(C(C(C1)CC2)(C)C)C(=O)O |
| InChI | 1S/C10H16O2/c1-10(2)7-4-3-6(5-7)8(10)9(11)12/h6-8H,3-5H2,1-2H3,(H,11,12)/t6-,7?,8?/m1/s1 |
| InChIKey | KJKODDSNIDHCKV-JECWYVHBSA-N |
| Density | 1.079g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.504°C at 760 mmHg (Cal.) |
| Flash point | 124.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R-Exo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Carboxylic Acid |