|
CAS#: 67634-25-7 Product: 2,4-Dimethyl-3-Cyclohexene-1-Methanyl Acetate No suppilers available for the product. |
| Name | 2,4-Dimethyl-3-Cyclohexene-1-Methanyl Acetate |
|---|---|
| Synonyms | Acetic Acid (3,5-Dimethyl-1-Cyclohex-3-Enyl)Methyl Ester; (3,5-Dimethyl-1-Cyclohex-3-Enyl)Methyl Ethanoate; 2,4-Dimethyl-3-Cyclohexene-1-Methanyl Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 67634-25-7 |
| EINECS | 266-830-2 |
| SMILES | C(OC(=O)C)C1CC(C=C(C1)C)C |
| InChI | 1S/C11H18O2/c1-8-4-9(2)6-11(5-8)7-13-10(3)12/h4,8,11H,5-7H2,1-3H3 |
| InChIKey | UBKMAHYFGPIVKA-UHFFFAOYSA-N |
| Density | 0.933g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.749°C at 760 mmHg (Cal.) |
| Flash point | 82.94°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-3-Cyclohexene-1-Methanyl Acetate |