|
CAS#: 67662-99-1 Product: 4-(5,5-Dimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-One No suppilers available for the product. |
| Name | 4-(5,5-Dimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-One |
|---|---|
| Synonyms | 3-Buten-2-One, 4-(5,5-Dimethyl-3-Cyclohexen-1-Yl)-; 4-(5,5-Dimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 67662-99-1 |
| EINECS | 266-844-9 |
| SMILES | CC1(CC(/C=C/C(=O)C)CC=C1)C |
| InChI | 1S/C12H18O/c1-10(13)6-7-11-5-4-8-12(2,3)9-11/h4,6-8,11H,5,9H2,1-3H3/b7-6+ |
| InChIKey | XHVGJHYNZGHEFV-VOTSOKGWSA-N |
| Density | 0.95g/cm3 (Cal.) |
|---|---|
| Boiling point | 256.262°C at 760 mmHg (Cal.) |
| Flash point | 105.682°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5,5-Dimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-One |