|
CAS#: 67736-26-9 Product: Guanosine-3',5'-Cyclic Phosphorothioate No suppilers available for the product. |
| Name | Guanosine-3',5'-Cyclic Phosphorothioate |
|---|---|
| Synonyms | 2-Amino-9-[(2R,5R)-5-(Dihydroxythiophosphoryloxymethyl)-4-Hydroxy-2,5-Dihydrofuran-2-Yl]-3H-Purin-6-One; Guanosine, Cyclic 3',5'-(Hydrogen Phosphorothioate); Guanosine-3',5'-Cyclic Phosphorothioate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N5O6PS |
| Molecular Weight | 361.27 |
| CAS Registry Number | 67736-26-9 |
| SMILES | [C@H]1(O[C@@H](C(=C1)O)CO[P](=S)(O)O)[N]2C3=C(N=C2)C(=O)N=C(N3)N |
| InChI | 1S/C10H12N5O6PS/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(21-6)2-20-22(18,19)23/h1,3,5-6,16H,2H2,(H2,18,19,23)(H3,11,13,14,17)/t5-,6-/m1/s1 |
| InChIKey | KBIVNMNCTHXFAZ-PHDIDXHHSA-N |
| Density | 2.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 835.028°C at 760 mmHg (Cal.) |
| Flash point | 458.809°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Guanosine-3',5'-Cyclic Phosphorothioate |