|
CAS#: 67764-99-2 Product: 5,N-Dimethyl-3-(4-Fluorophenyl)-4-Isoxazolecarboxamide No suppilers available for the product. |
| Name | 5,N-Dimethyl-3-(4-Fluorophenyl)-4-Isoxazolecarboxamide |
|---|---|
| Synonyms | 3-(4-Fluorophenyl)-N,5-Dimethyl-Isoxazole-4-Carboxamide; 3-(4-Fluorophenyl)-N,5-Dimethyl-4-Isoxazolecarboxamide; St5448574 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 |
| CAS Registry Number | 67764-99-2 |
| SMILES | C2=C(C1=NOC(=C1C(NC)=O)C)C=CC(=C2)F |
| InChI | 1S/C12H11FN2O2/c1-7-10(12(16)14-2)11(15-17-7)8-3-5-9(13)6-4-8/h3-6H,1-2H3,(H,14,16) |
| InChIKey | DVDZYPBJVUNUKM-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.103°C at 760 mmHg (Cal.) |
| Flash point | 184.285°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,N-Dimethyl-3-(4-Fluorophenyl)-4-Isoxazolecarboxamide |