|
CAS#: 67824-44-6 Product: 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-Hexadecafluoro-10-(Trifluoromethyl)Undecane-1,2-Diol No suppilers available for the product. |
| Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-Hexadecafluoro-10-(Trifluoromethyl)Undecane-1,2-Diol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H7F19O2 |
| Molecular Weight | 544.16 |
| CAS Registry Number | 67824-44-6 |
| EINECS | 267-218-8 |
| SMILES | C(O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C12H7F19O2/c13-4(14,1-3(33)2-32)6(16,17)8(20,21)10(24,25)9(22,23)7(18,19)5(15,11(26,27)28)12(29,30)31/h3,32-33H,1-2H2 |
| InChIKey | FYPAMSWJAKTIGA-UHFFFAOYSA-N |
| Density | 1.669g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.125°C at 760 mmHg (Cal.) |
| Flash point | 104.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-Hexadecafluoro-10-(Trifluoromethyl)Undecane-1,2-Diol |