Online Database of Chemicals from Around the World
|
CAS#: 67828-38-0 Product: 1,3-Dichloro-2-Ethoxy-5-Methyl-4-Nitrobenzene No suppilers available for the product. |
| Name | 1,3-Dichloro-2-Ethoxy-5-Methyl-4-Nitrobenzene |
|---|---|
| Synonyms | 1,3-Dichloro-2-Ethoxy-5-Methyl-4-Nitro-Benzene; 2,4-Dichloro-3-Ethoxy-6-Methylnitrobenzene; Benzene, 1,3-Dichloro-2-Ethoxy-5-Methyl-4-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 |
| CAS Registry Number | 67828-38-0 |
| SMILES | C1=C(C)C(=C(C(=C1Cl)OCC)Cl)[N+]([O-])=O |
| InChI | 1S/C9H9Cl2NO3/c1-3-15-9-6(10)4-5(2)8(7(9)11)12(13)14/h4H,3H2,1-2H3 |
| InChIKey | NHKYOVUIRFBTHE-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.863°C at 760 mmHg (Cal.) |
| Flash point | 164.182°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-2-Ethoxy-5-Methyl-4-Nitrobenzene |