|
CAS#: 67845-33-4 Product: 1-(1,1-Dimethylethyl)-2-Methoxy-3,5-Dimethylbenzene No suppilers available for the product. |
| Name | 1-(1,1-Dimethylethyl)-2-Methoxy-3,5-Dimethylbenzene |
|---|---|
| Synonyms | 1-Tert-Butyl-2-Methoxy-3,5-Dimethyl-Benzene; 6-Tert-Butyl-2,4-Dimethyl-1-Methoxybenzene; Benzene, 1-(1,1-Dimethylethyl)-2-Methoxy-3,5-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 67845-33-4 |
| SMILES | C1=C(C(=C(C=C1C)C(C)(C)C)OC)C |
| InChI | 1S/C13H20O/c1-9-7-10(2)12(14-6)11(8-9)13(3,4)5/h7-8H,1-6H3 |
| InChIKey | PZISTOMBMFSTQA-UHFFFAOYSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.86°C at 760 mmHg (Cal.) |
| Flash point | 96.663°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1,1-Dimethylethyl)-2-Methoxy-3,5-Dimethylbenzene |