|
CAS#: 67856-55-7 Product: 2'-Methoxy[1,1'-Biphenyl]-2-Carboxamide No suppilers available for the product. |
| Name | 2'-Methoxy[1,1'-Biphenyl]-2-Carboxamide |
|---|---|
| Synonyms | (1,1'-Biphenyl)-2-Carboxamide, 2'-Methoxy-; 2'-Methoxy(1,1'-Biphenyl)-2-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 67856-55-7 |
| EINECS | 267-387-8 |
| SMILES | C1=CC(=C(C=C1)C2=C(C=CC=C2)C(=O)N)OC |
| InChI | 1S/C14H13NO2/c1-17-13-9-5-4-7-11(13)10-6-2-3-8-12(10)14(15)16/h2-9H,1H3,(H2,15,16) |
| InChIKey | FGIMLEOUWYBPNF-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.281°C at 760 mmHg (Cal.) |
| Flash point | 175.298°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Methoxy[1,1'-Biphenyl]-2-Carboxamide |