|
CAS#: 67860-02-0 Product: 2-Methyl-4-Oxo-4H-Pyran-3-Yl Lactate No suppilers available for the product. |
| Name | 2-Methyl-4-Oxo-4H-Pyran-3-Yl Lactate |
|---|---|
| Synonyms | (2-Methyl-4-Oxo-Pyran-3-Yl) 2-Hydroxypropanoate; 2-Hydroxypropanoic Acid (2-Methyl-4-Oxo-3-Pyranyl) Ester; 2-Hydroxypropionic Acid (4-Keto-2-Methyl-Pyran-3-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.18 |
| CAS Registry Number | 67860-02-0 |
| EINECS | 267-436-3 |
| SMILES | CC1=C(C(=O)C=CO1)OC(=O)C(O)C |
| InChI | 1S/C9H10O5/c1-5(10)9(12)14-8-6(2)13-4-3-7(8)11/h3-5,10H,1-2H3 |
| InChIKey | MDIWGYQROJRXEW-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.479°C at 760 mmHg (Cal.) |
| Flash point | 149.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-Oxo-4H-Pyran-3-Yl Lactate |