|
CAS#: 67888-98-6 Product: 2,2',3,4,4',5'-Hexabromobiphenyl No suppilers available for the product. |
| Name | 2,2',3,4,4',5'-Hexabromobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,2',3,4,4',5'-Hexabromo-; 2,2',3,4,4',5'-Hexabromobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H4Br6 |
| Molecular Weight | 627.59 |
| CAS Registry Number | 67888-98-6 |
| SMILES | C1=C(C(=C(C(=C1)C2=CC(=C(C=C2Br)Br)Br)Br)Br)Br |
| InChI | 1S/C12H4Br6/c13-7-2-1-5(11(17)12(7)18)6-3-9(15)10(16)4-8(6)14/h1-4H |
| InChIKey | BSOYYFPGSFVZRZ-UHFFFAOYSA-N |
| Density | 2.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.537°C at 760 mmHg (Cal.) |
| Flash point | 234.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',3,4,4',5'-Hexabromobiphenyl |