|
CAS#: 679-36-7 Product: [1-(Difluoromethyl)-2,2-Difluoro-1-Hydroxyethyl]Phosphonic Acid Diethyl Ester No suppilers available for the product. |
| Name | [1-(Difluoromethyl)-2,2-Difluoro-1-Hydroxyethyl]Phosphonic Acid Diethyl Ester |
|---|---|
| Synonyms | 2-Diethoxyphosphoryl-1,1,3,3-Tetrafluoro-Propan-2-Ol; Ent 24,831; General Chemicals 3562 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13F4O4P |
| Molecular Weight | 268.14 |
| CAS Registry Number | 679-36-7 |
| SMILES | C(O[P](C(C(F)F)(C(F)F)O)(=O)OCC)C |
| InChI | 1S/C7H13F4O4P/c1-3-14-16(13,15-4-2)7(12,5(8)9)6(10)11/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | ZCNCEMNGTZGKLF-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.767°C at 760 mmHg (Cal.) |
| Flash point | 139.933°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1-(Difluoromethyl)-2,2-Difluoro-1-Hydroxyethyl]Phosphonic Acid Diethyl Ester |