|
CAS#: 67906-39-2 Product: 4-[Methyl[(Nonafluorobutyl)Sulphonyl]Amino]Butyl Methacrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Nonafluorobutyl)Sulphonyl]Amino]Butyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,4-Nonafluorobutylsulfonyl)Amino)Butyl Ester; 2-Methylacrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,4-Nonafluorobutylsulfonyl)Amino)Butyl Ester; 2-Methyl-2-Propenoic Acid, 4-(Methyl((Nonafluorobutyl)Sulfonyl)Amino)Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16F9NO4S |
| Molecular Weight | 453.32 |
| CAS Registry Number | 67906-39-2 |
| EINECS | 267-706-0 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C(=C)C |
| InChI | 1S/C13H16F9NO4S/c1-8(2)9(24)27-7-5-4-6-23(3)28(25,26)13(21,22)11(16,17)10(14,15)12(18,19)20/h1,4-7H2,2-3H3 |
| InChIKey | GJCCTHAVFKJHMN-UHFFFAOYSA-N |
| Density | 1.421g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.232°C at 760 mmHg (Cal.) |
| Flash point | 164.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Nonafluorobutyl)Sulphonyl]Amino]Butyl Methacrylate |