|
CAS#: 67923-62-0 Product: Dipotassium 2,2'-Methylenebis[3,4,6-Trichlorophenolate] No suppilers available for the product. |
| Name | Dipotassium 2,2'-Methylenebis[3,4,6-Trichlorophenolate] |
|---|---|
| Synonyms | Dipotassium 3,4,6-Trichloro-2-[(2,3,5-Trichloro-6-Oxido-Phenyl)Methyl]Phenolate; Dipotassium 3,4,6-Trichloro-2-(2,3,5-Trichloro-6-Oxido-Benzyl)Phenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H4Cl6K2O2 |
| Molecular Weight | 483.09 |
| CAS Registry Number | 67923-62-0 |
| EINECS | 267-778-3 |
| SMILES | C(C1=C([O-])C(=CC(=C1Cl)Cl)Cl)C2=C(Cl)C(=CC(=C2[O-])Cl)Cl.[K+].[K+] |
| InChI | 1S/C13H6Cl6O2.2K/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21;;/h2-3,20-21H,1H2;;/q;2*+1/p-2 |
| InChIKey | BIRRARIYKDWFJX-UHFFFAOYSA-L |
| Boiling point | 470.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 238.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipotassium 2,2'-Methylenebis[3,4,6-Trichlorophenolate] |