|
CAS#: 67923-76-6 Product: [Carbonylbis[Nitrilobis(Methylene)]]Tetrakisphosphonic Acid No suppilers available for the product. |
| Name | [Carbonylbis[Nitrilobis(Methylene)]]Tetrakisphosphonic Acid |
|---|---|
| Synonyms | [[(Bis(Phosphonomethyl)Amino)-Oxomethyl]-(Phosphonomethyl)Amino]Methylphosphonic Acid; (Carbonylbis(Nitrilobis(Methylene)))Tetrakisphosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H16N2O13P4 |
| Molecular Weight | 436.08 |
| CAS Registry Number | 67923-76-6 |
| EINECS | 267-783-0 |
| SMILES | C([P](=O)(O)O)N(C[P](=O)(O)O)C(=O)N(C[P](=O)(O)O)C[P](=O)(O)O |
| InChI | 1S/C5H16N2O13P4/c8-5(6(1-21(9,10)11)2-22(12,13)14)7(3-23(15,16)17)4-24(18,19)20/h1-4H2,(H2,9,10,11)(H2,12,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | QVOBKEISBGYEOZ-UHFFFAOYSA-N |
| Density | 2.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 1003.284°C at 760 mmHg (Cal.) |
| Flash point | 560.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [Carbonylbis[Nitrilobis(Methylene)]]Tetrakisphosphonic Acid |