|
CAS#: 68039-25-8 Product: 6,10,10-Trimethylbicyclo[7.2.0]Undeca-2,5-Diene-2-Ethanol No suppilers available for the product. |
| Name | 6,10,10-Trimethylbicyclo[7.2.0]Undeca-2,5-Diene-2-Ethanol |
|---|---|
| Synonyms | Bicyclo(7.2.0)Undeca-2,5-Diene-2-Ethanol, 6,10,10-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 |
| CAS Registry Number | 68039-25-8 |
| SMILES | C(\C1=C\C/C=C(CCC2C(CC12)(C)C)/C)CO |
| InChI | 1S/C16H26O/c1-12-5-4-6-13(9-10-17)14-11-16(2,3)15(14)8-7-12/h5-6,14-15,17H,4,7-11H2,1-3H3/b12-5-,13-6- |
| InChIKey | NCTFJDPCYOHLOD-VFWKFLPVSA-N |
| Density | 0.929g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.893°C at 760 mmHg (Cal.) |
| Flash point | 119.421°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,10,10-Trimethylbicyclo[7.2.0]Undeca-2,5-Diene-2-Ethanol |