|
CAS#: 68052-07-3 Product: 2,5-Diethoxy-N,N-Diethyl-4-Nitroaniline No suppilers available for the product. |
| Name | 2,5-Diethoxy-N,N-Diethyl-4-Nitroaniline |
|---|---|
| Synonyms | 2,5-Diethoxy-N,N-Diethyl-4-Nitro-Aniline; (2,5-Diethoxy-4-Nitro-Phenyl)-Diethyl-Amine; 4-Diethylamino-2,5-Diethoxy-1-Nitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 |
| CAS Registry Number | 68052-07-3 |
| EINECS | 268-300-6 |
| SMILES | C1=C(OCC)C(=CC(=C1[N+]([O-])=O)OCC)N(CC)CC |
| InChI | 1S/C14H22N2O4/c1-5-15(6-2)11-9-14(20-8-4)12(16(17)18)10-13(11)19-7-3/h9-10H,5-8H2,1-4H3 |
| InChIKey | WQOIVYJIJVSNFM-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.489°C at 760 mmHg (Cal.) |
| Flash point | 196.009°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diethoxy-N,N-Diethyl-4-Nitroaniline |