|
CAS#: 68052-19-7 Product: 1-(2-Ethoxy-4-Nitrophenyl)Pyrrolidine No suppilers available for the product. |
| Name | 1-(2-Ethoxy-4-Nitrophenyl)Pyrrolidine |
|---|---|
| Synonyms | 1-(2-Ethoxy-4-Nitro-Phenyl)Pyrrolidine; N-(2-Ethoxy-4-Nitrophenyl)Pyrrolidine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 68052-19-7 |
| EINECS | 268-312-1 |
| SMILES | C1=CC(=CC(=C1N2CCCC2)OCC)[N+]([O-])=O |
| InChI | 1S/C12H16N2O3/c1-2-17-12-9-10(14(15)16)5-6-11(12)13-7-3-4-8-13/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | KJWAQCRRFKAAIW-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.92°C at 760 mmHg (Cal.) |
| Flash point | 196.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Ethoxy-4-Nitrophenyl)Pyrrolidine |