|
CAS#: 68052-44-8 Product: 2,4-Dinitroso-1-Naphthol No suppilers available for the product. |
| Name | 2,4-Dinitroso-1-Naphthol |
|---|---|
| Synonyms | 2,4-Dinitroso-1-Naphthalenol; 2,4-Dinitroso-1-Naphthol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6N2O3 |
| Molecular Weight | 202.17 |
| CAS Registry Number | 68052-44-8 |
| EINECS | 268-323-1 |
| SMILES | C1=CC2=C(C=C1)C(=CC(=C2O)N=O)N=O |
| InChI | 1S/C10H6N2O3/c13-10-7-4-2-1-3-6(7)8(11-14)5-9(10)12-15/h1-5,13H |
| InChIKey | HCQUKMQNUZDSHU-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.516°C at 760 mmHg (Cal.) |
| Flash point | 239.569°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dinitroso-1-Naphthol |