Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 5-[(Butylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride |
|---|---|
| Synonyms | 5-(3-Butyl ureido)-2-ethoxy benzenesulfonyl chloride; 5-(3-Butylureido)-2-ethoxybenzene-1-sulfonyl chloride; 5-(3-Butyl-ureido)-2-ethoxybenzenesulfonyl |
| Molecular Structure | ![CAS#: 680618-18-2, 5-[(Butylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride](/moreStructures/680618-18-2.gif) |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.82 |
| CAS Registry Number | 680618-18-2 |
| SMILES | ClS(=O)(=O)c1cc(ccc1OCC)NC(=O)NCCCC |
| InChI | 1S/C13H19ClN2O4S/c1-3-5-8-15-13(17)16-10-6-7-11(20-4-2)12(9-10)21(14,18)19/h6-7,9H,3-5,8H2,1-2H3,(H2,15,16,17) |
| InChIKey | NVBIVUJFWSTKGZ-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.329°C at 760 mmHg (Cal.) |
| Flash point | 228.57°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[(Butylcarbamoyl)amino]-2-ethoxybenzenesulfonyl chloride |