Online Database of Chemicals from Around the World
|
CAS#: 68084-51-5 Product: Ethyl-5-Isopropyl-o-Cresol No suppilers available for the product. |
| Name | Ethyl-5-Isopropyl-o-Cresol |
|---|---|
| Synonyms | 3-Ethyl-5-Isopropyl-2-Methyl-Phenol; 3-Ethyl-5-Isopropyl-2-Methylphenol; 3-Ethyl-2-Methyl-5-Propan-2-Yl-Phenol |
| Molecular Structure |  |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 68084-51-5 |
| EINECS | 268-441-3 |
| SMILES | C1=C(C=C(C(=C1O)C)CC)C(C)C |
| InChI | 1S/C12H18O/c1-5-10-6-11(8(2)3)7-12(13)9(10)4/h6-8,13H,5H2,1-4H3 |
| InChIKey | QTWMLLOLEYPWJU-UHFFFAOYSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.38°C at 760 mmHg (Cal.) |
| Flash point | 125.612°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl-5-Isopropyl-o-Cresol |