Online Database of Chemicals from Around the World
| Name | Decafluoro(Pentafluoroethyl)Cyclohexanesulphonyl Fluoride |
|---|---|
| Synonyms | 1,2,2,3,3,4,5,5,6,6-Decafluoro-4-(1,1,2,2,2-Pentafluoroethyl)-1-Cyclohexanesulfonyl Fluoride; Cyclohexanesulfonyl Fluoride, Decafluoro(Pentafluoroethyl)-; Decafluoro(Pentafluoroethyl)Cyclohexanesulfonyl Fluoride |
| Molecular Structure |  |
| Molecular Formula | C8F16O2S |
| Molecular Weight | 464.12 |
| CAS Registry Number | 68156-06-9 |
| EINECS | 269-001-3 |
| SMILES | O=[S](=O)(C1(C(C(F)(F)C(C(C1(F)F)(F)F)(C(C(F)(F)F)(F)F)F)(F)F)F)F |
| InChI | 1S/C8F16O2S/c9-1(4(14,15)8(21,22)23)2(10,11)5(16,17)7(20,27(24,25)26)6(18,19)3(1,12)13 |
| InChIKey | ZUNLKLHLASQCRH-UHFFFAOYSA-N |
| Density | 1.882g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.074°C at 760 mmHg (Cal.) |
| Flash point | 76.012°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Decafluoro(Pentafluoroethyl)Cyclohexanesulphonyl Fluoride |
